C26H34Cl2N4O3 — CID 171486632
tert-butyl 4-[6-(2,3-dichloro-6-prop-2-enoxyphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl]-2,2-dimethylpiperidine-1-carboxylate (PubChem CID 171486632) has the molecular formula C26H34Cl2N4O3 and a molecular weight of 521.49 g/mol. Its IUPAC name is tert-butyl 4-[6-(2,3-dichloro-6-prop-2-enoxyphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl]-2,2-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(2,3-dichloro-6-prop-2-enoxyphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl]-2,2-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 171486632 |
| Molecular Formula | C26H34Cl2N4O3 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | tert-butyl 4-[6-(2,3-dichloro-6-prop-2-enoxyphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl]-2,2-dimethylpiperidine-1-carboxylate |
| SMILES | C=CCOc1ccc(Cl)c(Cl)c1C1Cc2nnc(C3CCN(C(=O)OC(C)(C)C)C(C)(C)C3)n2C1 |
| InChI | InChI=1S/C26H34Cl2N4O3/c1-7-12-34-19-9-8-18(27)22(28)21(19)17-13-20-29-30-23(31(20)15-17)16-10-11-32(26(5,6)14-16)24(33)35-25(2,3)4/h7-9,16-17H,1,10-15H2,2-6H3 |
| InChIKey | VQDIFFNJUVOQQB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|