C26H36Cl2N4O4 — CID 171486785
tert-butyl 4-[[[3-(2,3-dichloro-6-prop-2-enoxyphenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamoyl]-2,2-dimethylpiperidine-1-carboxylate (PubChem CID 171486785) has the molecular formula C26H36Cl2N4O4 and a molecular weight of 539.50 g/mol. Its IUPAC name is tert-butyl 4-[[[3-(2,3-dichloro-6-prop-2-enoxyphenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamoyl]-2,2-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[3-(2,3-dichloro-6-prop-2-enoxyphenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamoyl]-2,2-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 171486785 |
| Molecular Formula | C26H36Cl2N4O4 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | tert-butyl 4-[[[3-(2,3-dichloro-6-prop-2-enoxyphenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamoyl]-2,2-dimethylpiperidine-1-carboxylate |
| SMILES | C=CCOc1ccc(Cl)c(Cl)c1C1CN=C(NNC(=O)C2CCN(C(=O)OC(C)(C)C)C(C)(C)C2)C1 |
| InChI | InChI=1S/C26H36Cl2N4O4/c1-7-12-35-19-9-8-18(27)22(28)21(19)17-13-20(29-15-17)30-31-23(33)16-10-11-32(26(5,6)14-16)24(34)36-25(2,3)4/h7-9,16-17H,1,10-15H2,2-6H3,(H,29,30)(H,31,33) |
| InChIKey | ZBGDDAORYKJATO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|