C15H16ClN5O2 — CID 171499358
1-[(3R)-3-[3-chloro-5-(2-methyltetrazol-5-yl)phenyl]morpholin-4-yl]prop-2-en-1-one (PubChem CID 171499358) has the molecular formula C15H16ClN5O2 and a molecular weight of 333.78 g/mol. Its IUPAC name is 1-[(3R)-3-[3-chloro-5-(2-methyltetrazol-5-yl)phenyl]morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[3-chloro-5-(2-methyltetrazol-5-yl)phenyl]morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171499358 |
| Molecular Formula | C15H16ClN5O2 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-[(3R)-3-[3-chloro-5-(2-methyltetrazol-5-yl)phenyl]morpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOC[C@H]1c1cc(Cl)cc(-c2nnn(C)n2)c1 |
| InChI | InChI=1S/C15H16ClN5O2/c1-3-14(22)21-4-5-23-9-13(21)10-6-11(8-12(16)7-10)15-17-19-20(2)18-15/h3,6-8,13H,1,4-5,9H2,2H3/t13-/m0/s1 |
| InChIKey | JGGSXLHCCVSUHL-ZDUSSCGKSA-N |
| XLogP | 1.62 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|