C18H22ClNO3 — CID 178181793
2-[3-[3-chloro-5-(oxan-4-yl)phenyl]morpholin-4-yl]prop-2-enal (PubChem CID 178181793) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is 2-[3-[3-chloro-5-(oxan-4-yl)phenyl]morpholin-4-yl]prop-2-enal.
| Compound Name | 2-[3-[3-chloro-5-(oxan-4-yl)phenyl]morpholin-4-yl]prop-2-enal |
|---|---|
| PubChem CID | 178181793 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-[3-[3-chloro-5-(oxan-4-yl)phenyl]morpholin-4-yl]prop-2-enal |
| SMILES | C=C(C=O)N1CCOCC1c1cc(Cl)cc(C2CCOCC2)c1 |
| InChI | InChI=1S/C18H22ClNO3/c1-13(11-21)20-4-7-23-12-18(20)16-8-15(9-17(19)10-16)14-2-5-22-6-3-14/h8-11,14,18H,1-7,12H2 |
| InChIKey | LGYXTTWEBBXEJX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|