C18H19ClN4O3 — CID 171499495
1-[(3R)-3-[3-(5-amino-6-methoxypyrazin-2-yl)-5-chlorophenyl]morpholin-4-yl]prop-2-en-1-one (PubChem CID 171499495) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is 1-[(3R)-3-[3-(5-amino-6-methoxypyrazin-2-yl)-5-chlorophenyl]morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[3-(5-amino-6-methoxypyrazin-2-yl)-5-chlorophenyl]morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171499495 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-[(3R)-3-[3-(5-amino-6-methoxypyrazin-2-yl)-5-chlorophenyl]morpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOC[C@H]1c1cc(Cl)cc(-c2cnc(N)c(OC)n2)c1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-3-16(24)23-4-5-26-10-15(23)12-6-11(7-13(19)8-12)14-9-21-17(20)18(22-14)25-2/h3,6-9,15H,1,4-5,10H2,2H3,(H2,20,21)/t15-/m0/s1 |
| InChIKey | BSTDNEAGQCYYNC-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|