C15H14Cl2N6O2 — CID 176590697
(E)-1-[(3R)-3-[2-(4-amino-1,3,5-triazin-2-yl)-6-chloro-4-pyridinyl]morpholin-4-yl]-3-chloroprop-2-en-1-one (PubChem CID 176590697) has the molecular formula C15H14Cl2N6O2 and a molecular weight of 381.22 g/mol. Its IUPAC name is (E)-1-[(3R)-3-[2-(4-amino-1,3,5-triazin-2-yl)-6-chloro-4-pyridinyl]morpholin-4-yl]-3-chloroprop-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-[2-(4-amino-1,3,5-triazin-2-yl)-6-chloro-4-pyridinyl]morpholin-4-yl]-3-chloroprop-2-en-1-one |
|---|---|
| PubChem CID | 176590697 |
| Molecular Formula | C15H14Cl2N6O2 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (E)-1-[(3R)-3-[2-(4-amino-1,3,5-triazin-2-yl)-6-chloro-4-pyridinyl]morpholin-4-yl]-3-chloroprop-2-en-1-one |
| SMILES | Nc1ncnc(-c2cc([C@@H]3COCCN3C(=O)/C=C/Cl)cc(Cl)n2)n1 |
| InChI | InChI=1S/C15H14Cl2N6O2/c16-2-1-13(24)23-3-4-25-7-11(23)9-5-10(21-12(17)6-9)14-19-8-20-15(18)22-14/h1-2,5-6,8,11H,3-4,7H2,(H2,18,19,20,22)/b2-1+/t11-/m0/s1 |
| InChIKey | MIVWXIWHHQKOPV-GXFZAYBSSA-N |
| XLogP | 1.82 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|