C18H17ClF2N4O2 — CID 175632195
1-[(3R)-3-[2-chloro-6-(6-methylpyrimidin-4-yl)-4-pyridinyl]-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one (PubChem CID 175632195) has the molecular formula C18H17ClF2N4O2 and a molecular weight of 394.81 g/mol. Its IUPAC name is 1-[(3R)-3-[2-chloro-6-(6-methylpyrimidin-4-yl)-4-pyridinyl]-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[2-chloro-6-(6-methylpyrimidin-4-yl)-4-pyridinyl]-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175632195 |
| Molecular Formula | C18H17ClF2N4O2 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[(3R)-3-[2-chloro-6-(6-methylpyrimidin-4-yl)-4-pyridinyl]-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C(C(F)F)COC[C@H]1c1cc(Cl)nc(-c2cc(C)ncn2)c1 |
| InChI | InChI=1S/C18H17ClF2N4O2/c1-3-17(26)25-14(7-27-8-15(25)18(20)21)11-5-13(24-16(19)6-11)12-4-10(2)22-9-23-12/h3-6,9,14-15,18H,1,7-8H2,2H3/t14-,15?/m0/s1 |
| InChIKey | WSKNGHHBSDIPKF-MLCCFXAWSA-N |
| XLogP | 3.22 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|