C20H17ClF2N4O2 — CID 175632166
1-[(3R)-3-(2-chloro-6-imidazo[1,2-a]pyridin-7-yl-4-pyridinyl)-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one (PubChem CID 175632166) has the molecular formula C20H17ClF2N4O2 and a molecular weight of 418.83 g/mol. Its IUPAC name is 1-[(3R)-3-(2-chloro-6-imidazo[1,2-a]pyridin-7-yl-4-pyridinyl)-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-(2-chloro-6-imidazo[1,2-a]pyridin-7-yl-4-pyridinyl)-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175632166 |
| Molecular Formula | C20H17ClF2N4O2 |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-[(3R)-3-(2-chloro-6-imidazo[1,2-a]pyridin-7-yl-4-pyridinyl)-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C(C(F)F)COC[C@H]1c1cc(Cl)nc(-c2ccn3ccnc3c2)c1 |
| InChI | InChI=1S/C20H17ClF2N4O2/c1-2-19(28)27-15(10-29-11-16(27)20(22)23)13-7-14(25-17(21)8-13)12-3-5-26-6-4-24-18(26)9-12/h2-9,15-16,20H,1,10-11H2/t15-,16?/m0/s1 |
| InChIKey | URZIKCQBRPJDHX-VYRBHSGPSA-N |
| XLogP | 3.77 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|