C14H16Cl2N2O2 — CID 171499540
1-[5-(2,6-dichloro-4-pyridinyl)-2,2-dimethylmorpholin-4-yl]prop-2-en-1-one (PubChem CID 171499540) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-[5-(2,6-dichloro-4-pyridinyl)-2,2-dimethylmorpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[5-(2,6-dichloro-4-pyridinyl)-2,2-dimethylmorpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171499540 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-[5-(2,6-dichloro-4-pyridinyl)-2,2-dimethylmorpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C)(C)OCC1c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c1-4-13(19)18-8-14(2,3)20-7-10(18)9-5-11(15)17-12(16)6-9/h4-6,10H,1,7-8H2,2-3H3 |
| InChIKey | XTFUOVNCZRWMCL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|