C19H20ClN3O2 — CID 171499185
1-[(3R)-3-[3-chloro-5-(1-cyclopropylpyrazol-4-yl)phenyl]morpholin-4-yl]prop-2-en-1-one (PubChem CID 171499185) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 1-[(3R)-3-[3-chloro-5-(1-cyclopropylpyrazol-4-yl)phenyl]morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[3-chloro-5-(1-cyclopropylpyrazol-4-yl)phenyl]morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171499185 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-[(3R)-3-[3-chloro-5-(1-cyclopropylpyrazol-4-yl)phenyl]morpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOC[C@H]1c1cc(Cl)cc(-c2cnn(C3CC3)c2)c1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-2-19(24)22-5-6-25-12-18(22)14-7-13(8-16(20)9-14)15-10-21-23(11-15)17-3-4-17/h2,7-11,17-18H,1,3-6,12H2/t18-/m0/s1 |
| InChIKey | IBXUCBBFJSJFAS-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|