C19H19ClN4O2 — CID 171499253
1-[6-[3-(2-aminopyrimidin-4-yl)-5-chlorophenyl]-4-oxa-7-azaspiro[2.5]octan-7-yl]prop-2-en-1-one (PubChem CID 171499253) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 1-[6-[3-(2-aminopyrimidin-4-yl)-5-chlorophenyl]-4-oxa-7-azaspiro[2.5]octan-7-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[3-(2-aminopyrimidin-4-yl)-5-chlorophenyl]-4-oxa-7-azaspiro[2.5]octan-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171499253 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-[6-[3-(2-aminopyrimidin-4-yl)-5-chlorophenyl]-4-oxa-7-azaspiro[2.5]octan-7-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CC2)OCC1c1cc(Cl)cc(-c2ccnc(N)n2)c1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-2-17(25)24-11-19(4-5-19)26-10-16(24)13-7-12(8-14(20)9-13)15-3-6-22-18(21)23-15/h2-3,6-9,16H,1,4-5,10-11H2,(H2,21,22,23) |
| InChIKey | VSERSSRNPZGIIL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|