C14H13BrClF2NO2 — CID 171499553
1-[(3R,5S)-3-(3-bromo-5-chlorophenyl)-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one (PubChem CID 171499553) has the molecular formula C14H13BrClF2NO2 and a molecular weight of 380.62 g/mol. Its IUPAC name is 1-[(3R,5S)-3-(3-bromo-5-chlorophenyl)-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,5S)-3-(3-bromo-5-chlorophenyl)-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171499553 |
| Molecular Formula | C14H13BrClF2NO2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 1-[(3R,5S)-3-(3-bromo-5-chlorophenyl)-5-(difluoromethyl)morpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1[C@H](c2cc(Cl)cc(Br)c2)COC[C@H]1C(F)F |
| InChI | InChI=1S/C14H13BrClF2NO2/c1-2-13(20)19-11(6-21-7-12(19)14(17)18)8-3-9(15)5-10(16)4-8/h2-5,11-12,14H,1,6-7H2/t11-,12-/m0/s1 |
| InChIKey | XVNSYORUBZMZCP-RYUDHWBXSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|