C21H29ClN6O4 — CID 171499401
tert-butyl (3R)-3-[3-[4-amino-6-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]-5-chlorophenyl]morpholine-4-carboxylate (PubChem CID 171499401) has the molecular formula C21H29ClN6O4 and a molecular weight of 464.95 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-[4-amino-6-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]-5-chlorophenyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-[4-amino-6-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]-5-chlorophenyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 171499401 |
| Molecular Formula | C21H29ClN6O4 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | tert-butyl (3R)-3-[3-[4-amino-6-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]-5-chlorophenyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@H]1c1cc(Cl)cc(-c2nc(N)nc(NCCCO)n2)c1 |
| InChI | InChI=1S/C21H29ClN6O4/c1-21(2,3)32-20(30)28-6-8-31-12-16(28)13-9-14(11-15(22)10-13)17-25-18(23)27-19(26-17)24-5-4-7-29/h9-11,16,29H,4-8,12H2,1-3H3,(H3,23,24,25,26,27)/t16-/m0/s1 |
| InChIKey | NDTSVEPGEXVLRT-INIZCTEOSA-N |
| XLogP | 2.88 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|