C23H35ClN6O3 — CID 171499063
tert-butyl morpholine-4-carboxylate;N-[4-(3-chlorophenyl)-1,3,5-triazin-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 171499063) has the molecular formula C23H35ClN6O3 and a molecular weight of 479.03 g/mol. Its IUPAC name is tert-butyl morpholine-4-carboxylate;N-[4-(3-chlorophenyl)-1,3,5-triazin-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | tert-butyl morpholine-4-carboxylate;N-[4-(3-chlorophenyl)-1,3,5-triazin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 171499063 |
| Molecular Formula | C23H35ClN6O3 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | tert-butyl morpholine-4-carboxylate;N-[4-(3-chlorophenyl)-1,3,5-triazin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1.CN(C)CCCNc1ncnc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H18ClN5.C9H17NO3/c1-20(2)8-4-7-16-14-18-10-17-13(19-14)11-5-3-6-12(15)9-11;1-9(2,3)13-8(11)10-4-6-12-7-5-10/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,16,17,18,19);4-7H2,1-3H3 |
| InChIKey | LORWPGAWKURSME-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|