C22H32ClN5O4 — CID 171499396
tert-butyl morpholine-4-carboxylate;3-[[4-(3-chlorophenyl)-1,3,5-triazin-2-yl]amino]propanal;methane (PubChem CID 171499396) has the molecular formula C22H32ClN5O4 and a molecular weight of 465.98 g/mol. Its IUPAC name is tert-butyl morpholine-4-carboxylate;3-[[4-(3-chlorophenyl)-1,3,5-triazin-2-yl]amino]propanal;methane.
| Compound Name | tert-butyl morpholine-4-carboxylate;3-[[4-(3-chlorophenyl)-1,3,5-triazin-2-yl]amino]propanal;methane |
|---|---|
| PubChem CID | 171499396 |
| Molecular Formula | C22H32ClN5O4 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | tert-butyl morpholine-4-carboxylate;3-[[4-(3-chlorophenyl)-1,3,5-triazin-2-yl]amino]propanal;methane |
| SMILES | C.CC(C)(C)OC(=O)N1CCOCC1.O=CCCNc1ncnc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C12H11ClN4O.C9H17NO3.CH4/c13-10-4-1-3-9(7-10)11-15-8-16-12(17-11)14-5-2-6-18;1-9(2,3)13-8(11)10-4-6-12-7-5-10;/h1,3-4,6-8H,2,5H2,(H,14,15,16,17);4-7H2,1-3H3;1H4 |
| InChIKey | HMVGLYDPZHYIIB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|