C21H31BClNO3S — CID 175633583
1-[3-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-4-yl]-2,2-dimethylpropane-1-thione (PubChem CID 175633583) has the molecular formula C21H31BClNO3S and a molecular weight of 423.82 g/mol. Its IUPAC name is 1-[3-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-4-yl]-2,2-dimethylpropane-1-thione.
| Compound Name | 1-[3-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-4-yl]-2,2-dimethylpropane-1-thione |
|---|---|
| PubChem CID | 175633583 |
| Molecular Formula | C21H31BClNO3S |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[3-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-4-yl]-2,2-dimethylpropane-1-thione |
| SMILES | CC(C)(C)C(=S)N1CCOCC1c1cc(Cl)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H31BClNO3S/c1-19(2,3)18(28)24-8-9-25-13-17(24)14-10-15(12-16(23)11-14)22-26-20(4,5)21(6,7)27-22/h10-12,17H,8-9,13H2,1-7H3 |
| InChIKey | VBJDKEPAXRHWKP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|