C17H25BClNO3 — CID 171499390
3-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylmorpholine (PubChem CID 171499390) has the molecular formula C17H25BClNO3 and a molecular weight of 337.66 g/mol. Its IUPAC name is 3-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylmorpholine.
| Compound Name | 3-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylmorpholine |
|---|---|
| PubChem CID | 171499390 |
| Molecular Formula | C17H25BClNO3 |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 3-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylmorpholine |
| SMILES | CC1(c2cc(Cl)cc(B3OC(C)(C)C(C)(C)O3)c2)COCCN1 |
| InChI | InChI=1S/C17H25BClNO3/c1-15(2)16(3,4)23-18(22-15)13-8-12(9-14(19)10-13)17(5)11-21-7-6-20-17/h8-10,20H,6-7,11H2,1-5H3 |
| InChIKey | ZSSNRVXUUYDMMH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|