C13H26N2 — CID 171505896
(Z)-3-hexan-3-ylimino-2,4-dimethylpent-1-en-1-amine (PubChem CID 171505896) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is (Z)-3-hexan-3-ylimino-2,4-dimethylpent-1-en-1-amine.
| Compound Name | (Z)-3-hexan-3-ylimino-2,4-dimethylpent-1-en-1-amine |
|---|---|
| PubChem CID | 171505896 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (Z)-3-hexan-3-ylimino-2,4-dimethylpent-1-en-1-amine |
| SMILES | CCCC(CC)/N=C(C(/C)=C\N)\C(C)C |
| InChI | InChI=1S/C13H26N2/c1-6-8-12(7-2)15-13(10(3)4)11(5)9-14/h9-10,12H,6-8,14H2,1-5H3/b11-9-,15-13+ |
| InChIKey | IFIYVLPOCNVUNN-NPEMSZEQSA-N |
| XLogP | 3.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|