C23H31N5O3 — CID 171511719
N-[3-[N-[[5-(2-methoxyethoxy)-1H-pyrrol-2-yl]methylidene]carbamimidoyl]-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide;molecular hydrogen (PubChem CID 171511719) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[3-[N-[[5-(2-methoxyethoxy)-1H-pyrrol-2-yl]methylidene]carbamimidoyl]-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide;molecular hydrogen.
| Compound Name | N-[3-[N-[[5-(2-methoxyethoxy)-1H-pyrrol-2-yl]methylidene]carbamimidoyl]-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 171511719 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[3-[N-[[5-(2-methoxyethoxy)-1H-pyrrol-2-yl]methylidene]carbamimidoyl]-4-methylphenyl]-6-azabicyclo[3.1.1]heptane-6-carboxamide;molecular hydrogen |
| SMILES | [H]/N=C(\N=C\c1ccc(OCCOC)[nH]1)c1cc(NC(=O)N2C3CCCC2C3)ccc1C.[H][H] |
| InChI | InChI=1S/C23H29N5O3.H2/c1-15-6-7-16(27-23(29)28-18-4-3-5-19(28)13-18)12-20(15)22(24)25-14-17-8-9-21(26-17)31-11-10-30-2;/h6-9,12,14,18-19,24,26H,3-5,10-11,13H2,1-2H3,(H,27,29);1H/b24-22-,25-14+; |
| InChIKey | CMJZJDKTNOIQPX-NJGPPXLPSA-N |
| XLogP | 4.20 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|