C19H17F4N3O2S — CID 171514593
3-(3-fluoroazetidin-1-yl)-N-methyl-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide (PubChem CID 171514593) has the molecular formula C19H17F4N3O2S and a molecular weight of 427.42 g/mol. Its IUPAC name is 3-(3-fluoroazetidin-1-yl)-N-methyl-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide.
| Compound Name | 3-(3-fluoroazetidin-1-yl)-N-methyl-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide |
|---|---|
| PubChem CID | 171514593 |
| Molecular Formula | C19H17F4N3O2S |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-(3-fluoroazetidin-1-yl)-N-methyl-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)c(N1CC(F)C1)cn2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F4N3O2S/c1-24-29(27,28)15-6-7-17-16(8-15)18(25-9-13(20)10-25)11-26(17)14-4-2-12(3-5-14)19(21,22)23/h2-8,11,13,24H,9-10H2,1H3 |
| InChIKey | YOVHHIUBUGQKLA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |