C22H16F4N2O2S — CID 171514609
3-(2-fluorophenyl)-N-methyl-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide (PubChem CID 171514609) has the molecular formula C22H16F4N2O2S and a molecular weight of 448.44 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-methyl-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide.
| Compound Name | 3-(2-fluorophenyl)-N-methyl-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide |
|---|---|
| PubChem CID | 171514609 |
| Molecular Formula | C22H16F4N2O2S |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-(2-fluorophenyl)-N-methyl-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)c(-c1ccccc1F)cn2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H16F4N2O2S/c1-27-31(29,30)16-10-11-21-18(12-16)19(17-4-2-3-5-20(17)23)13-28(21)15-8-6-14(7-9-15)22(24,25)26/h2-13,27H,1H3 |
| InChIKey | VGVOHSMLTBWTRZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |