C18H17F3N2O3S — CID 171786914
N,3,3-trimethyl-2-oxo-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide (PubChem CID 171786914) has the molecular formula C18H17F3N2O3S and a molecular weight of 398.41 g/mol. Its IUPAC name is N,3,3-trimethyl-2-oxo-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide.
| Compound Name | N,3,3-trimethyl-2-oxo-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide |
|---|---|
| PubChem CID | 171786914 |
| Molecular Formula | C18H17F3N2O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N,3,3-trimethyl-2-oxo-1-[4-(trifluoromethyl)phenyl]indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)C(C)(C)C(=O)N2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N2O3S/c1-17(2)14-10-13(27(25,26)22-3)8-9-15(14)23(16(17)24)12-6-4-11(5-7-12)18(19,20)21/h4-10,22H,1-3H3 |
| InChIKey | UPSXCNGKQRMSIT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |