C15H12F3N3O3S — CID 171786919
N-methyl-2-oxo-1-[5-(trifluoromethyl)-2-pyridinyl]-3H-indole-5-sulfonamide (PubChem CID 171786919) has the molecular formula C15H12F3N3O3S and a molecular weight of 371.34 g/mol. Its IUPAC name is N-methyl-2-oxo-1-[5-(trifluoromethyl)-2-pyridinyl]-3H-indole-5-sulfonamide.
| Compound Name | N-methyl-2-oxo-1-[5-(trifluoromethyl)-2-pyridinyl]-3H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 171786919 |
| Molecular Formula | C15H12F3N3O3S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-methyl-2-oxo-1-[5-(trifluoromethyl)-2-pyridinyl]-3H-indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CC(=O)N2c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H12F3N3O3S/c1-19-25(23,24)11-3-4-12-9(6-11)7-14(22)21(12)13-5-2-10(8-20-13)15(16,17)18/h2-6,8,19H,7H2,1H3 |
| InChIKey | JPNKTIMBIOJBRC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |