C8H14N2O2 — CID 171517022
6-oxa-2,9-diazaspiro[4.5]decane-9-carbaldehyde (PubChem CID 171517022) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 6-oxa-2,9-diazaspiro[4.5]decane-9-carbaldehyde.
| Compound Name | 6-oxa-2,9-diazaspiro[4.5]decane-9-carbaldehyde |
|---|---|
| PubChem CID | 171517022 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 6-oxa-2,9-diazaspiro[4.5]decane-9-carbaldehyde |
| SMILES | O=CN1CCOC2(CCNC2)C1 |
| InChI | InChI=1S/C8H14N2O2/c11-7-10-3-4-12-8(6-10)1-2-9-5-8/h7,9H,1-6H2 |
| InChIKey | QFGIPOXPRYEUJG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|