C20H28N2O4 — CID 171517547
2-(2-aminoethyl)-3,3-dimethyl-N-[2-(4-methyl-2-oxochromen-7-yl)oxyethyl]butanamide (PubChem CID 171517547) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-(2-aminoethyl)-3,3-dimethyl-N-[2-(4-methyl-2-oxochromen-7-yl)oxyethyl]butanamide.
| Compound Name | 2-(2-aminoethyl)-3,3-dimethyl-N-[2-(4-methyl-2-oxochromen-7-yl)oxyethyl]butanamide |
|---|---|
| PubChem CID | 171517547 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-(2-aminoethyl)-3,3-dimethyl-N-[2-(4-methyl-2-oxochromen-7-yl)oxyethyl]butanamide |
| SMILES | Cc1cc(=O)oc2cc(OCCNC(=O)C(CCN)C(C)(C)C)ccc12 |
| InChI | InChI=1S/C20H28N2O4/c1-13-11-18(23)26-17-12-14(5-6-15(13)17)25-10-9-22-19(24)16(7-8-21)20(2,3)4/h5-6,11-12,16H,7-10,21H2,1-4H3,(H,22,24) |
| InChIKey | LWRIGTZDMULHDP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|