C30H42N2O8 — CID 144806973
tert-butyl N-[2-[2-[2-[[2-(4-methyl-2-oxochromen-7-yl)oxy-2-(4-methylphenyl)acetyl]amino]ethoxy]ethoxy]ethyl]carbamate;molecular hydrogen (PubChem CID 144806973) has the molecular formula C30H42N2O8 and a molecular weight of 558.67 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[2-(4-methyl-2-oxochromen-7-yl)oxy-2-(4-methylphenyl)acetyl]amino]ethoxy]ethoxy]ethyl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[2-[2-[2-[[2-(4-methyl-2-oxochromen-7-yl)oxy-2-(4-methylphenyl)acetyl]amino]ethoxy]ethoxy]ethyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 144806973 |
| Molecular Formula | C30H42N2O8 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[2-(4-methyl-2-oxochromen-7-yl)oxy-2-(4-methylphenyl)acetyl]amino]ethoxy]ethoxy]ethyl]carbamate;molecular hydrogen |
| SMILES | Cc1ccc(C(Oc2ccc3c(C)cc(=O)oc3c2)C(=O)NCCOCCOCCNC(=O)OC(C)(C)C)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C30H38N2O8.2H2/c1-20-6-8-22(9-7-20)27(38-23-10-11-24-21(2)18-26(33)39-25(24)19-23)28(34)31-12-14-36-16-17-37-15-13-32-29(35)40-30(3,4)5;;/h6-11,18-19,27H,12-17H2,1-5H3,(H,31,34)(H,32,35);2*1H |
| InChIKey | RMCFPQWZHPUDPI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|