About (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate
(4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate (PubChem CID 171523792) has the molecular formula C17H19ClF2N2O3
and a molecular weight of 372.80 g/mol. Its IUPAC name is (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate |
| PubChem CID | 171523792 |
| Molecular Formula | C17H19ClF2N2O3 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1)N1CC(N2CCCCC2=O)CC(F)(F)C1 |
| InChI | InChI=1S/C17H19ClF2N2O3/c18-12-4-6-14(7-5-12)25-16(24)21-10-13(9-17(19,20)11-21)22-8-2-1-3-15(22)23/h4-7,13H,1-3,8-11H2 |
| InChIKey | OWEDSTWHUOPTAZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate?
The IUPAC name of (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate (CID 171523792) is (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate.
What is the SMILES notation for (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate?
The canonical SMILES for (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate is O=C(Oc1ccc(Cl)cc1)N1CC(N2CCCCC2=O)CC(F)(F)C1.
What is the InChIKey of (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate?
The InChIKey is OWEDSTWHUOPTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClF2N2O3/c18-12-4-6-14(7-5-12)25-16(24)21-10-13(9-17(19,20)11-21)22-8-2-1-3-15(22)23/h4-7,13H,1-3,8-11H2.
What are the key properties of (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate?
(4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate has a molecular weight of 372.80 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 3,3-difluoro-5-(2-oxopiperidin-1-yl)piperidine-1-carboxylate is sourced from PubChem (CID 171523792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).