C26H41N2PS — CID 171526591
[2,4,6-triethyl-N-[2-(2,4,6-triethylanilino)ethyl]anilino]phosphinothious acid (PubChem CID 171526591) has the molecular formula C26H41N2PS and a molecular weight of 444.67 g/mol. Its IUPAC name is [2,4,6-triethyl-N-[2-(2,4,6-triethylanilino)ethyl]anilino]phosphinothious acid.
| Compound Name | [2,4,6-triethyl-N-[2-(2,4,6-triethylanilino)ethyl]anilino]phosphinothious acid |
|---|---|
| PubChem CID | 171526591 |
| Molecular Formula | C26H41N2PS |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | [2,4,6-triethyl-N-[2-(2,4,6-triethylanilino)ethyl]anilino]phosphinothious acid |
| SMILES | CCc1cc(CC)c(NCCN(PS)c2c(CC)cc(CC)cc2CC)c(CC)c1 |
| InChI | InChI=1S/C26H41N2PS/c1-7-19-15-21(9-3)25(22(10-4)16-19)27-13-14-28(29-30)26-23(11-5)17-20(8-2)18-24(26)12-6/h15-18,27,29-30H,7-14H2,1-6H3 |
| InChIKey | QHMDECDCNOUVOI-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|