C23H34ClN3 — CID 87161674
N'-chloro-N'-[(2,6-diethylanilino)methyl]-N-(2,6-diethylphenyl)ethane-1,2-diamine (PubChem CID 87161674) has the molecular formula C23H34ClN3 and a molecular weight of 388.00 g/mol. Its IUPAC name is N'-chloro-N'-[(2,6-diethylanilino)methyl]-N-(2,6-diethylphenyl)ethane-1,2-diamine.
| Compound Name | N'-chloro-N'-[(2,6-diethylanilino)methyl]-N-(2,6-diethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 87161674 |
| Molecular Formula | C23H34ClN3 |
| Molecular Weight | 388.00 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | N'-chloro-N'-[(2,6-diethylanilino)methyl]-N-(2,6-diethylphenyl)ethane-1,2-diamine |
| SMILES | CCc1cccc(CC)c1NCCN(Cl)CNc1c(CC)cccc1CC |
| InChI | InChI=1S/C23H34ClN3/c1-5-18-11-9-12-19(6-2)22(18)25-15-16-27(24)17-26-23-20(7-3)13-10-14-21(23)8-4/h9-14,25-26H,5-8,15-17H2,1-4H3 |
| InChIKey | TZDQNCTTYOYPDV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.00 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|