C26H29F6N9O2 — CID 171531987
1-tert-butyl-N-[[3-[7-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(1,1,2,2,2-pentafluoroethyl)indazol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide (PubChem CID 171531987) has the molecular formula C26H29F6N9O2 and a molecular weight of 613.57 g/mol. Its IUPAC name is 1-tert-butyl-N-[[3-[7-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(1,1,2,2,2-pentafluoroethyl)indazol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[[3-[7-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(1,1,2,2,2-pentafluoroethyl)indazol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171531987 |
| Molecular Formula | C26H29F6N9O2 |
| Molecular Weight | 613.57 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 1-tert-butyl-N-[[3-[7-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(1,1,2,2,2-pentafluoroethyl)indazol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide |
| SMILES | CN1CC[C@@H](Nc2cccc3c(C(F)(F)C(F)(F)F)n(-c4noc(CNC(=O)c5cnn(C(C)(C)C)c5)n4)nc23)[C@@H](F)C1 |
| InChI | InChI=1S/C26H29F6N9O2/c1-24(2,3)40-12-14(10-34-40)22(42)33-11-19-36-23(38-43-19)41-21(25(28,29)26(30,31)32)15-6-5-7-18(20(15)37-41)35-17-8-9-39(4)13-16(17)27/h5-7,10,12,16-17,35H,8-9,11,13H2,1-4H3,(H,33,42)/t16-,17+/m0/s1 |
| InChIKey | TYAYXGYDWCLRCQ-DLBZAZTESA-N |
| XLogP | 4.40 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|