C16H23ClO3Si — CID 171535419
[4-[2-[chloro(dimethyl)silyl]butoxy]phenyl] 2-methylprop-2-enoate (PubChem CID 171535419) has the molecular formula C16H23ClO3Si and a molecular weight of 326.90 g/mol. Its IUPAC name is [4-[2-[chloro(dimethyl)silyl]butoxy]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[chloro(dimethyl)silyl]butoxy]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171535419 |
| Molecular Formula | C16H23ClO3Si |
| Molecular Weight | 326.90 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [4-[2-[chloro(dimethyl)silyl]butoxy]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(OCC(CC)[Si](C)(C)Cl)cc1 |
| InChI | InChI=1S/C16H23ClO3Si/c1-6-15(21(4,5)17)11-19-13-7-9-14(10-8-13)20-16(18)12(2)3/h7-10,15H,2,6,11H2,1,3-5H3 |
| InChIKey | DINFOZQKGPINIB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|