C30H43FN6O — CID 171540232
N-[4-[4-[2-[[(3R)-1-(3-fluorophenyl)piperidin-3-yl]-propan-2-ylamino]-4-pyridinyl]piperazin-1-yl]butyl]prop-2-enamide (PubChem CID 171540232) has the molecular formula C30H43FN6O and a molecular weight of 522.71 g/mol. Its IUPAC name is N-[4-[4-[2-[[(3R)-1-(3-fluorophenyl)piperidin-3-yl]-propan-2-ylamino]-4-pyridinyl]piperazin-1-yl]butyl]prop-2-enamide.
| Compound Name | N-[4-[4-[2-[[(3R)-1-(3-fluorophenyl)piperidin-3-yl]-propan-2-ylamino]-4-pyridinyl]piperazin-1-yl]butyl]prop-2-enamide |
|---|---|
| PubChem CID | 171540232 |
| Molecular Formula | C30H43FN6O |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | N-[4-[4-[2-[[(3R)-1-(3-fluorophenyl)piperidin-3-yl]-propan-2-ylamino]-4-pyridinyl]piperazin-1-yl]butyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCCN1CCN(c2ccnc(N(C(C)C)[C@@H]3CCCN(c4cccc(F)c4)C3)c2)CC1 |
| InChI | InChI=1S/C30H43FN6O/c1-4-30(38)33-13-5-6-15-34-17-19-35(20-18-34)27-12-14-32-29(22-27)37(24(2)3)28-11-8-16-36(23-28)26-10-7-9-25(31)21-26/h4,7,9-10,12,14,21-22,24,28H,1,5-6,8,11,13,15-20,23H2,2-3H3,(H,33,38)/t28-/m1/s1 |
| InChIKey | WVXHPVPOFADSEE-MUUNZHRXSA-N |
| XLogP | 4.31 |
| TPSA | 54.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|