C13H16O4 — CID 171541480
ethyl 6-methyl-2-prop-2-enoyloxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 171541480) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 6-methyl-2-prop-2-enoyloxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | ethyl 6-methyl-2-prop-2-enoyloxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 171541480 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | ethyl 6-methyl-2-prop-2-enoyloxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=CC(=O)OC1=C(C(=O)OCC)C(C)CC=C1 |
| InChI | InChI=1S/C13H16O4/c1-4-11(14)17-10-8-6-7-9(3)12(10)13(15)16-5-2/h4,6,8-9H,1,5,7H2,2-3H3 |
| InChIKey | CWVQPZZLNPDOHC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|