C21H36N2O2S — CID 171541796
ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol (PubChem CID 171541796) has the molecular formula C21H36N2O2S and a molecular weight of 380.60 g/mol. Its IUPAC name is ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol.
| Compound Name | ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 171541796 |
| Molecular Formula | C21H36N2O2S |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol |
| SMILES | CC.CC.CC.Cc1cc(CN2CCS(=O)CC2)c2cccnc2c1O |
| InChI | InChI=1S/C15H18N2O2S.3C2H6/c1-11-9-12(10-17-5-7-20(19)8-6-17)13-3-2-4-16-14(13)15(11)18;3*1-2/h2-4,9,18H,5-8,10H2,1H3;3*1-2H3 |
| InChIKey | KYCFSLWEAQPRHS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |