About ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol
ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol (PubChem CID 171541796) has the molecular formula C21H36N2O2S
and a molecular weight of 380.60 g/mol. Its IUPAC name is ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol.
Molecular Properties
| Compound Name | ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol |
| PubChem CID | 171541796 |
| Molecular Formula | C21H36N2O2S |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol |
| SMILES | CC.CC.CC.Cc1cc(CN2CCS(=O)CC2)c2cccnc2c1O |
| InChI | InChI=1S/C15H18N2O2S.3C2H6/c1-11-9-12(10-17-5-7-20(19)8-6-17)13-3-2-4-16-14(13)15(11)18;3*1-2/h2-4,9,18H,5-8,10H2,1H3;3*1-2H3 |
| InChIKey | KYCFSLWEAQPRHS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol?
The IUPAC name of ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol (CID 171541796) is ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol.
What is the SMILES notation for ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol?
The canonical SMILES for ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol is CC.CC.CC.Cc1cc(CN2CCS(=O)CC2)c2cccnc2c1O.
What is the InChIKey of ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol?
The InChIKey is KYCFSLWEAQPRHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S.3C2H6/c1-11-9-12(10-17-5-7-20(19)8-6-17)13-3-2-4-16-14(13)15(11)18;3*1-2/h2-4,9,18H,5-8,10H2,1H3;3*1-2H3.
What are the key properties of ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol?
ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol has a molecular weight of 380.60 g/mol, XLogP of 4.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)methyl]quinolin-8-ol is sourced from PubChem (CID 171541796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).