About (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid
(4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid (PubChem CID 171546092) has the molecular formula C15H16Cl2N2O4
and a molecular weight of 359.21 g/mol. Its IUPAC name is (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid |
| PubChem CID | 171546092 |
| Molecular Formula | C15H16Cl2N2O4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)N1C[C@H](NC(=O)Cc2ccc(Cl)cc2Cl)CC1C(=O)O |
| InChI | InChI=1S/C15H16Cl2N2O4/c1-8(20)19-7-11(6-13(19)15(22)23)18-14(21)4-9-2-3-10(16)5-12(9)17/h2-3,5,11,13H,4,6-7H2,1H3,(H,18,21)(H,22,23)/t11-,13?/m1/s1 |
| InChIKey | BWKWMACIDQIZNV-JTDNENJMSA-N |
| XLogP | 1.73 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid?
The IUPAC name of (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid (CID 171546092) is (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid?
The canonical SMILES for (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid is CC(=O)N1C[C@H](NC(=O)Cc2ccc(Cl)cc2Cl)CC1C(=O)O.
What is the InChIKey of (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid?
The InChIKey is BWKWMACIDQIZNV-JTDNENJMSA-N. The full InChI is InChI=1S/C15H16Cl2N2O4/c1-8(20)19-7-11(6-13(19)15(22)23)18-14(21)4-9-2-3-10(16)5-12(9)17/h2-3,5,11,13H,4,6-7H2,1H3,(H,18,21)(H,22,23)/t11-,13?/m1/s1.
What are the key properties of (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid?
(4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid has a molecular weight of 359.21 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-acetyl-4-[[2-(2,4-dichlorophenyl)acetyl]amino]pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 171546092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).