C16H28N4O9 — CID 171548782
5-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetyl]oxy-methylamino]-5-oxopentanoic acid (PubChem CID 171548782) has the molecular formula C16H28N4O9 and a molecular weight of 420.42 g/mol. Its IUPAC name is 5-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetyl]oxy-methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetyl]oxy-methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 171548782 |
| Molecular Formula | C16H28N4O9 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 5-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetyl]oxy-methylamino]-5-oxopentanoic acid |
| SMILES | CN(OC(=O)COCCOCCOCCOCCN=[N+]=[N-])C(=O)CCCC(=O)O |
| InChI | InChI=1S/C16H28N4O9/c1-20(14(21)3-2-4-15(22)23)29-16(24)13-28-12-11-27-10-9-26-8-7-25-6-5-18-19-17/h2-13H2,1H3,(H,22,23) |
| InChIKey | YTSHRRRRSPPRAB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|