C21H32N10O7 — CID 171550361
(2S)-N'-[(2S)-1-[[(2S)-1-amino-6-diazo-1,5-dioxohexan-2-yl]amino]-6-diazo-1,5-dioxohexan-2-yl]-2-[[2-(dimethylamino)acetyl]amino]pentanediamide (PubChem CID 171550361) has the molecular formula C21H32N10O7 and a molecular weight of 536.55 g/mol. Its IUPAC name is (2S)-N'-[(2S)-1-[[(2S)-1-amino-6-diazo-1,5-dioxohexan-2-yl]amino]-6-diazo-1,5-dioxohexan-2-yl]-2-[[2-(dimethylamino)acetyl]amino]pentanediamide.
| Compound Name | (2S)-N'-[(2S)-1-[[(2S)-1-amino-6-diazo-1,5-dioxohexan-2-yl]amino]-6-diazo-1,5-dioxohexan-2-yl]-2-[[2-(dimethylamino)acetyl]amino]pentanediamide |
|---|---|
| PubChem CID | 171550361 |
| Molecular Formula | C21H32N10O7 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | (2S)-N'-[(2S)-1-[[(2S)-1-amino-6-diazo-1,5-dioxohexan-2-yl]amino]-6-diazo-1,5-dioxohexan-2-yl]-2-[[2-(dimethylamino)acetyl]amino]pentanediamide |
| SMILES | CN(C)CC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(N)=O)C(N)=O |
| InChI | InChI=1S/C21H32N10O7/c1-31(2)11-18(35)28-14(19(22)36)7-8-17(34)29-16(6-4-13(33)10-27-25)21(38)30-15(20(23)37)5-3-12(32)9-26-24/h9-10,14-16H,3-8,11H2,1-2H3,(H2,22,36)(H2,23,37)(H,28,35)(H,29,34)(H,30,38)/t14-,15-,16-/m0/s1 |
| InChIKey | YXYSSNDTCDGAEM-JYJNAYRXSA-N |
| XLogP | -3.95 |
| TPSA | 283.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|