C19H39N5O2 — CID 171554404
N-[6-[[(Z)-2-amino-3-[amino(pentyl)amino]prop-2-enoyl]amino]hexyl]-3-methylbutanamide (PubChem CID 171554404) has the molecular formula C19H39N5O2 and a molecular weight of 369.55 g/mol. Its IUPAC name is N-[6-[[(Z)-2-amino-3-[amino(pentyl)amino]prop-2-enoyl]amino]hexyl]-3-methylbutanamide.
| Compound Name | N-[6-[[(Z)-2-amino-3-[amino(pentyl)amino]prop-2-enoyl]amino]hexyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 171554404 |
| Molecular Formula | C19H39N5O2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | N-[6-[[(Z)-2-amino-3-[amino(pentyl)amino]prop-2-enoyl]amino]hexyl]-3-methylbutanamide |
| SMILES | CCCCCN(N)/C=C(\N)C(=O)NCCCCCCNC(=O)CC(C)C |
| InChI | InChI=1S/C19H39N5O2/c1-4-5-10-13-24(21)15-17(20)19(26)23-12-9-7-6-8-11-22-18(25)14-16(2)3/h15-16H,4-14,20-21H2,1-3H3,(H,22,25)(H,23,26)/b17-15- |
| InChIKey | AFHMSIZTCBWIPA-ICFOKQHNSA-N |
| XLogP | 1.99 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|