C19H30F3N5O6 — CID 171556592
methyl 6-[(3,4-dihydroxyoxan-2-yl)methylcarbamoylamino]hexanoate;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171556592) has the molecular formula C19H30F3N5O6 and a molecular weight of 481.47 g/mol. Its IUPAC name is methyl 6-[(3,4-dihydroxyoxan-2-yl)methylcarbamoylamino]hexanoate;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | methyl 6-[(3,4-dihydroxyoxan-2-yl)methylcarbamoylamino]hexanoate;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171556592 |
| Molecular Formula | C19H30F3N5O6 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | methyl 6-[(3,4-dihydroxyoxan-2-yl)methylcarbamoylamino]hexanoate;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | COC(=O)CCCCCNC(=O)NCC1OCCC(O)C1O.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H26N2O6.C5H4F3N3/c1-21-12(18)5-3-2-4-7-15-14(20)16-9-11-13(19)10(17)6-8-22-11;6-5(7,8)3-1-10-2-4(9)11-3/h10-11,13,17,19H,2-9H2,1H3,(H2,15,16,20);1-2H,(H2,9,11) |
| InChIKey | CHHKOGJRISVQMN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 168.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|