C20H23F3N4O3 — CID 171556875
(2R,3R,4R,5S)-2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171556875) has the molecular formula C20H23F3N4O3 and a molecular weight of 424.42 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171556875 |
| Molecular Formula | C20H23F3N4O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (2R,3R,4R,5S)-2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)CO[C@@H]1CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H23F3N4O3/c21-20(22,23)16-7-24-8-17(26-16)25-14-11-30-15(19(29)18(14)28)10-27-6-5-12-3-1-2-4-13(12)9-27/h1-4,7-8,14-15,18-19,28-29H,5-6,9-11H2,(H,25,26)/t14-,15+,18+,19-/m0/s1 |
| InChIKey | SMCDTTRKPFSPAO-SFUIVIKGSA-N |
| XLogP | 1.45 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |