C21H25F3LiN3O4-2 — CID 171556977
lithium;(2R,3R,4S,5S)-2-[[di(ethyl)amino]methyl]-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol;2H-pyridin-2-ide (PubChem CID 171556977) has the molecular formula C21H25F3LiN3O4-2 and a molecular weight of 447.38 g/mol. Its IUPAC name is lithium;(2R,3R,4S,5S)-2-[[di(ethyl)amino]methyl]-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol;2H-pyridin-2-ide.
| Compound Name | lithium;(2R,3R,4S,5S)-2-[[di(ethyl)amino]methyl]-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol;2H-pyridin-2-ide |
|---|---|
| PubChem CID | 171556977 |
| Molecular Formula | C21H25F3LiN3O4-2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | lithium;(2R,3R,4S,5S)-2-[[di(ethyl)amino]methyl]-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol;2H-pyridin-2-ide |
| SMILES | [CH2-]CN(C[CH2-])C[C@H]1OC[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O.[Li+].[c-]1ccccn1 |
| InChI | InChI=1S/C16H21F3N2O4.C5H4N.Li/c1-3-21(4-2)8-10-14(22)15(23)11(9-24-10)25-13-7-5-6-12(20-13)16(17,18)19;1-2-4-6-5-3-1;/h5-7,10-11,14-15,22-23H,1-4,8-9H2;1-4H;/q-2;-1;+1/t10-,11+,14+,15-;;/m1../s1 |
| InChIKey | ZLPANYXDYUYMMG-HBQSKVEDSA-N |
| XLogP | -1.18 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|