C21H23F3LiN2O5- — CID 171557076
lithium (Z)-N-[1-[[(3aS,4R,6R,7S,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methoxy]ethenyl]prop-2-en-1-imine (PubChem CID 171557076) has the molecular formula C21H23F3LiN2O5- and a molecular weight of 447.36 g/mol. Its IUPAC name is lithium (Z)-N-[1-[[(3aS,4R,6R,7S,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methoxy]ethenyl]prop-2-en-1-imine.
| Compound Name | lithium (Z)-N-[1-[[(3aS,4R,6R,7S,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methoxy]ethenyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 171557076 |
| Molecular Formula | C21H23F3LiN2O5- |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | lithium (Z)-N-[1-[[(3aS,4R,6R,7S,7aR)-2,2,4-trimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]oxy]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methoxy]ethenyl]prop-2-en-1-imine |
| SMILES | [H]/[C-]=C(/N=C\C=[C-]\[H])OC[C@H]1O[C@H](C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1Oc1cccc(C(F)(F)F)n1.[Li+] |
| InChI | InChI=1S/C21H23F3N2O5.Li/c1-6-10-25-13(3)27-11-14-18(19-17(12(2)28-14)30-20(4,5)31-19)29-16-9-7-8-15(26-16)21(22,23)24;/h1,3,6-10,12,14,17-19H,11H2,2,4-5H3;/q-2;+1/b25-10-;/t12-,14-,17+,18+,19+;/m1./s1 |
| InChIKey | JDFVJZGLSKVULG-NHRUVRTASA-N |
| XLogP | 0.51 |
| TPSA | 71.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|