C21H31F3N6O3 — CID 171557162
N-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methyl]-1-[[(Z)-3-(methylideneamino)prop-2-enylidene]amino]propan-2-amine;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557162) has the molecular formula C21H31F3N6O3 and a molecular weight of 472.51 g/mol. Its IUPAC name is N-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methyl]-1-[[(Z)-3-(methylideneamino)prop-2-enylidene]amino]propan-2-amine;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methyl]-1-[[(Z)-3-(methylideneamino)prop-2-enylidene]amino]propan-2-amine;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557162 |
| Molecular Formula | C21H31F3N6O3 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | N-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methyl]-1-[[(Z)-3-(methylideneamino)prop-2-enylidene]amino]propan-2-amine;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | C=N/C=C\C=N\CC(C)NCC1OCCC2OC(C)(C)OC12.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H27N3O3.C5H4F3N3/c1-12(10-18-8-5-7-17-4)19-11-14-15-13(6-9-20-14)21-16(2,3)22-15;6-5(7,8)3-1-10-2-4(9)11-3/h5,7-8,12-15,19H,4,6,9-11H2,1-3H3;1-2H,(H2,9,11)/b7-5-,18-8+; |
| InChIKey | PURYIECEDHQQOW-BOOQKLLTSA-N |
| XLogP | 2.64 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|