C21H27F4N3O8 — CID 171557307
2-[2-[2-[[(3aS,4R,7S,7aR)-7-[[3-fluoro-6-(trifluoromethyl)-2-pyridinyl]amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid (PubChem CID 171557307) has the molecular formula C21H27F4N3O8 and a molecular weight of 525.45 g/mol. Its IUPAC name is 2-[2-[2-[[(3aS,4R,7S,7aR)-7-[[3-fluoro-6-(trifluoromethyl)-2-pyridinyl]amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[(3aS,4R,7S,7aR)-7-[[3-fluoro-6-(trifluoromethyl)-2-pyridinyl]amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171557307 |
| Molecular Formula | C21H27F4N3O8 |
| Molecular Weight | 525.45 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 2-[2-[2-[[(3aS,4R,7S,7aR)-7-[[3-fluoro-6-(trifluoromethyl)-2-pyridinyl]amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1nc(C(F)(F)F)ccc1F)CO[C@@H]2CNC(=O)COCCOCC(=O)O |
| InChI | InChI=1S/C21H27F4N3O8/c1-20(2)35-17-12(27-19-11(22)3-4-14(28-19)21(23,24)25)8-34-13(18(17)36-20)7-26-15(29)9-32-5-6-33-10-16(30)31/h3-4,12-13,17-18H,5-10H2,1-2H3,(H,26,29)(H,27,28)(H,30,31)/t12-,13+,17+,18-/m0/s1 |
| InChIKey | UEOGVXZVHVZGJC-DECQCQTCSA-N |
| XLogP | 1.17 |
| TPSA | 137.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|