C16H22F2N2O4 — CID 171558317
[(3aR,4R,7S,7aR)-7-[[6-(1,1-difluoroethyl)-2-pyridinyl]amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanol (PubChem CID 171558317) has the molecular formula C16H22F2N2O4 and a molecular weight of 344.36 g/mol. Its IUPAC name is [(3aR,4R,7S,7aR)-7-[[6-(1,1-difluoroethyl)-2-pyridinyl]amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanol.
| Compound Name | [(3aR,4R,7S,7aR)-7-[[6-(1,1-difluoroethyl)-2-pyridinyl]amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanol |
|---|---|
| PubChem CID | 171558317 |
| Molecular Formula | C16H22F2N2O4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [(3aR,4R,7S,7aR)-7-[[6-(1,1-difluoroethyl)-2-pyridinyl]amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cccc(C(C)(F)F)n1)CO[C@@H]2CO |
| InChI | InChI=1S/C16H22F2N2O4/c1-15(2)23-13-9(8-22-10(7-21)14(13)24-15)19-12-6-4-5-11(20-12)16(3,17)18/h4-6,9-10,13-14,21H,7-8H2,1-3H3,(H,19,20)/t9-,10+,13+,14-/m0/s1 |
| InChIKey | CZBOFIVQMCMVLT-PJQZNRQZSA-N |
| XLogP | 1.88 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |