C15H19F4N3O3 — CID 171556817
N-[(3aS,4R,7S,7aR)-4-(aminomethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-3-fluoro-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 171556817) has the molecular formula C15H19F4N3O3 and a molecular weight of 365.33 g/mol. Its IUPAC name is N-[(3aS,4R,7S,7aR)-4-(aminomethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-3-fluoro-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(3aS,4R,7S,7aR)-4-(aminomethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-3-fluoro-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171556817 |
| Molecular Formula | C15H19F4N3O3 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[(3aS,4R,7S,7aR)-4-(aminomethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-3-fluoro-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1nc(C(F)(F)F)ccc1F)CO[C@@H]2CN |
| InChI | InChI=1S/C15H19F4N3O3/c1-14(2)24-11-8(6-23-9(5-20)12(11)25-14)21-13-7(16)3-4-10(22-13)15(17,18)19/h3-4,8-9,11-12H,5-6,20H2,1-2H3,(H,21,22)/t8-,9+,11+,12-/m0/s1 |
| InChIKey | OMJPCLYRWFHCTP-SPFNVWMYSA-N |
| XLogP | 1.90 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |