C19H28F3NO4 — CID 171557336
2-[(2R,3R,4R,5R,6R)-4,6-diethyl-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-3-yl]oxypropan-2-ol (PubChem CID 171557336) has the molecular formula C19H28F3NO4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R,6R)-4,6-diethyl-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2R,3R,4R,5R,6R)-4,6-diethyl-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 171557336 |
| Molecular Formula | C19H28F3NO4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-[(2R,3R,4R,5R,6R)-4,6-diethyl-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-3-yl]oxypropan-2-ol |
| SMILES | CC[C@H]1[C@@H](OC(C)(C)O)[C@@H](C)O[C@H](CC)[C@@H]1Oc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H28F3NO4/c1-6-12-16(27-18(4,5)24)11(3)25-13(7-2)17(12)26-15-10-8-9-14(23-15)19(20,21)22/h8-13,16-17,24H,6-7H2,1-5H3/t11-,12+,13-,16+,17-/m1/s1 |
| InChIKey | DAAZMEKPFLZHFH-BBAXIROVSA-N |
| XLogP | 4.18 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|