C10H13ClF3N — CID 171557687
(E)-3-chloro-N-[(E)-1,1,1-trifluorohex-2-en-2-yl]but-2-en-1-imine (PubChem CID 171557687) has the molecular formula C10H13ClF3N and a molecular weight of 239.67 g/mol. Its IUPAC name is (E)-3-chloro-N-[(E)-1,1,1-trifluorohex-2-en-2-yl]but-2-en-1-imine.
| Compound Name | (E)-3-chloro-N-[(E)-1,1,1-trifluorohex-2-en-2-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 171557687 |
| Molecular Formula | C10H13ClF3N |
| Molecular Weight | 239.67 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | (E)-3-chloro-N-[(E)-1,1,1-trifluorohex-2-en-2-yl]but-2-en-1-imine |
| SMILES | CCC/C=C(/N=C/C=C(\C)Cl)C(F)(F)F |
| InChI | InChI=1S/C10H13ClF3N/c1-3-4-5-9(10(12,13)14)15-7-6-8(2)11/h5-7H,3-4H2,1-2H3/b8-6+,9-5+,15-7+ |
| InChIKey | QTTWLDZRLCKKEQ-DKOKTEPSSA-N |
| XLogP | 4.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|