C8H9ClF3N — CID 170732021
(E)-4-chloro-1,1,1-trifluoro-N-prop-1-en-2-ylpent-3-en-2-imine (PubChem CID 170732021) has the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. Its IUPAC name is (E)-4-chloro-1,1,1-trifluoro-N-prop-1-en-2-ylpent-3-en-2-imine.
| Compound Name | (E)-4-chloro-1,1,1-trifluoro-N-prop-1-en-2-ylpent-3-en-2-imine |
|---|---|
| PubChem CID | 170732021 |
| Molecular Formula | C8H9ClF3N |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (E)-4-chloro-1,1,1-trifluoro-N-prop-1-en-2-ylpent-3-en-2-imine |
| SMILES | C=C(C)/N=C(/C=C(\C)Cl)C(F)(F)F |
| InChI | InChI=1S/C8H9ClF3N/c1-5(2)13-7(4-6(3)9)8(10,11)12/h4H,1H2,2-3H3/b6-4+,13-7- |
| InChIKey | SVNYDYKPWPLHHC-VKIZFATHSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|