C15H22F3N3O3 — CID 171558049
[(7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine;6-(trifluoromethyl)pyridin-2-amine (PubChem CID 171558049) has the molecular formula C15H22F3N3O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is [(7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine;6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | [(7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine;6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171558049 |
| Molecular Formula | C15H22F3N3O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | [(7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine;6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1(C)OC2C(CN)OCC[C@H]2O1.Nc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H17NO3.C6H5F3N2/c1-9(2)12-6-3-4-11-7(5-10)8(6)13-9;7-6(8,9)4-2-1-3-5(10)11-4/h6-8H,3-5,10H2,1-2H3;1-3H,(H2,10,11)/t6-,7?,8?;/m1./s1 |
| InChIKey | CULMPRSIKZFGIC-PUFYQOQHSA-N |
| XLogP | 1.94 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |